C18H24N2O — CID 143753296
(E,2E)-N-(3-aminophenyl)-2-(3-methylbut-2-enylidene)hept-3-enamide (PubChem CID 143753296) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is (E,2E)-N-(3-aminophenyl)-2-(3-methylbut-2-enylidene)hept-3-enamide.
| Compound Name | (E,2E)-N-(3-aminophenyl)-2-(3-methylbut-2-enylidene)hept-3-enamide |
|---|---|
| PubChem CID | 143753296 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (E,2E)-N-(3-aminophenyl)-2-(3-methylbut-2-enylidene)hept-3-enamide |
| SMILES | CCC/C=C/C(=C\C=C(C)C)C(=O)Nc1cccc(N)c1 |
| InChI | InChI=1S/C18H24N2O/c1-4-5-6-8-15(12-11-14(2)3)18(21)20-17-10-7-9-16(19)13-17/h6-13H,4-5,19H2,1-3H3,(H,20,21)/b8-6+,15-12+ |
| InChIKey | CYSQGYYUKRPVLB-QWPOMPHKSA-N |
| XLogP | 4.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|