C12H20N3O6+ — CID 70618013
2-(3-aminoanilino)-2-oxoacetic acid;tris(hydroxymethyl)-methylazanium (PubChem CID 70618013) has the molecular formula C12H20N3O6+ and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-(3-aminoanilino)-2-oxoacetic acid;tris(hydroxymethyl)-methylazanium.
| Compound Name | 2-(3-aminoanilino)-2-oxoacetic acid;tris(hydroxymethyl)-methylazanium |
|---|---|
| PubChem CID | 70618013 |
| Molecular Formula | C12H20N3O6+ |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-(3-aminoanilino)-2-oxoacetic acid;tris(hydroxymethyl)-methylazanium |
| SMILES | C[N+](CO)(CO)CO.Nc1cccc(NC(=O)C(=O)O)c1 |
| InChI | InChI=1S/C8H8N2O3.C4H12NO3/c9-5-2-1-3-6(4-5)10-7(11)8(12)13;1-5(2-6,3-7)4-8/h1-4H,9H2,(H,10,11)(H,12,13);6-8H,2-4H2,1H3/q;+1 |
| InChIKey | RWLIMZRLUFKNLV-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|