C9H9NO4S — CID 21442505
2-(3-methylsulfinylanilino)-2-oxoacetic acid (PubChem CID 21442505) has the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. Its IUPAC name is 2-(3-methylsulfinylanilino)-2-oxoacetic acid.
| Compound Name | 2-(3-methylsulfinylanilino)-2-oxoacetic acid |
|---|---|
| PubChem CID | 21442505 |
| Molecular Formula | C9H9NO4S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 2-(3-methylsulfinylanilino)-2-oxoacetic acid |
| SMILES | CS(=O)c1cccc(NC(=O)C(=O)O)c1 |
| InChI | InChI=1S/C9H9NO4S/c1-15(14)7-4-2-3-6(5-7)10-8(11)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13) |
| InChIKey | DGUFMYBCTCVLKF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|