C14H22N2O2S2 — CID 97109150
1-methyl-1-[(2R)-1-methylsulfanylbutan-2-yl]-3-[3-[(S)-methylsulfinyl]phenyl]urea (PubChem CID 97109150) has the molecular formula C14H22N2O2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 1-methyl-1-[(2R)-1-methylsulfanylbutan-2-yl]-3-[3-[(S)-methylsulfinyl]phenyl]urea.
| Compound Name | 1-methyl-1-[(2R)-1-methylsulfanylbutan-2-yl]-3-[3-[(S)-methylsulfinyl]phenyl]urea |
|---|---|
| PubChem CID | 97109150 |
| Molecular Formula | C14H22N2O2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-methyl-1-[(2R)-1-methylsulfanylbutan-2-yl]-3-[3-[(S)-methylsulfinyl]phenyl]urea |
| SMILES | CC[C@H](CSC)N(C)C(=O)Nc1cccc([S@](C)=O)c1 |
| InChI | InChI=1S/C14H22N2O2S2/c1-5-12(10-19-3)16(2)14(17)15-11-7-6-8-13(9-11)20(4)18/h6-9,12H,5,10H2,1-4H3,(H,15,17)/t12-,20+/m1/s1 |
| InChIKey | NJKBCOMICXZOTN-ODXCJYRJSA-N |
| XLogP | 3.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |