C12H18FN3OS — CID 99600049
3-(5-fluoro-2-pyridinyl)-1-methyl-1-[(2S)-1-methylsulfanylbutan-2-yl]urea (PubChem CID 99600049) has the molecular formula C12H18FN3OS and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-(5-fluoro-2-pyridinyl)-1-methyl-1-[(2S)-1-methylsulfanylbutan-2-yl]urea.
| Compound Name | 3-(5-fluoro-2-pyridinyl)-1-methyl-1-[(2S)-1-methylsulfanylbutan-2-yl]urea |
|---|---|
| PubChem CID | 99600049 |
| Molecular Formula | C12H18FN3OS |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-(5-fluoro-2-pyridinyl)-1-methyl-1-[(2S)-1-methylsulfanylbutan-2-yl]urea |
| SMILES | CC[C@@H](CSC)N(C)C(=O)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C12H18FN3OS/c1-4-10(8-18-3)16(2)12(17)15-11-6-5-9(13)7-14-11/h5-7,10H,4,8H2,1-3H3,(H,14,15,17)/t10-/m0/s1 |
| InChIKey | PUHHPFAMBDDBEV-JTQLQIEISA-N |
| XLogP | 2.83 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |