C10H14FN3O — CID 137354634
(2S)-N'-(5-fluoro-2-pyridinyl)-2-methylbutanehydrazide (PubChem CID 137354634) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is (2S)-N'-(5-fluoro-2-pyridinyl)-2-methylbutanehydrazide.
| Compound Name | (2S)-N'-(5-fluoro-2-pyridinyl)-2-methylbutanehydrazide |
|---|---|
| PubChem CID | 137354634 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | (2S)-N'-(5-fluoro-2-pyridinyl)-2-methylbutanehydrazide |
| SMILES | CC[C@H](C)C(=O)NNc1ccc(F)cn1 |
| InChI | InChI=1S/C10H14FN3O/c1-3-7(2)10(15)14-13-9-5-4-8(11)6-12-9/h4-7H,3H2,1-2H3,(H,12,13)(H,14,15)/t7-/m0/s1 |
| InChIKey | HLZCVMHKBKNLIJ-ZETCQYMHSA-N |
| XLogP | 1.71 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|