C13H17FN2O2 — CID 47141193
N'-[2-(4-fluorophenyl)acetyl]-2-methylbutanehydrazide (PubChem CID 47141193) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)acetyl]-2-methylbutanehydrazide.
| Compound Name | N'-[2-(4-fluorophenyl)acetyl]-2-methylbutanehydrazide |
|---|---|
| PubChem CID | 47141193 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | N'-[2-(4-fluorophenyl)acetyl]-2-methylbutanehydrazide |
| SMILES | CCC(C)C(=O)NNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FN2O2/c1-3-9(2)13(18)16-15-12(17)8-10-4-6-11(14)7-5-10/h4-7,9H,3,8H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | HVSGDVPPUZAAQB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|