C22H28FN3O3 — CID 60543893
1-[[2-(4-fluorophenyl)acetyl]amino]-3-[4-(4-propan-2-yloxyphenyl)butan-2-yl]urea (PubChem CID 60543893) has the molecular formula C22H28FN3O3 and a molecular weight of 401.48 g/mol. Its IUPAC name is 1-[[2-(4-fluorophenyl)acetyl]amino]-3-[4-(4-propan-2-yloxyphenyl)butan-2-yl]urea.
| Compound Name | 1-[[2-(4-fluorophenyl)acetyl]amino]-3-[4-(4-propan-2-yloxyphenyl)butan-2-yl]urea |
|---|---|
| PubChem CID | 60543893 |
| Molecular Formula | C22H28FN3O3 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 1-[[2-(4-fluorophenyl)acetyl]amino]-3-[4-(4-propan-2-yloxyphenyl)butan-2-yl]urea |
| SMILES | CC(CCc1ccc(OC(C)C)cc1)NC(=O)NNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H28FN3O3/c1-15(2)29-20-12-8-17(9-13-20)5-4-16(3)24-22(28)26-25-21(27)14-18-6-10-19(23)11-7-18/h6-13,15-16H,4-5,14H2,1-3H3,(H,25,27)(H2,24,26,28) |
| InChIKey | HNJKJHCPGDHLKW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|