C21H26FN3O3 — CID 33158981
2-[(4-fluorophenyl)methylcarbamoylamino]-N-[2-(4-propan-2-yloxyphenyl)ethyl]acetamide (PubChem CID 33158981) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[2-(4-propan-2-yloxyphenyl)ethyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[2-(4-propan-2-yloxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 33158981 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[2-(4-propan-2-yloxyphenyl)ethyl]acetamide |
| SMILES | CC(C)Oc1ccc(CCNC(=O)CNC(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H26FN3O3/c1-15(2)28-19-9-5-16(6-10-19)11-12-23-20(26)14-25-21(27)24-13-17-3-7-18(22)8-4-17/h3-10,15H,11-14H2,1-2H3,(H,23,26)(H2,24,25,27) |
| InChIKey | BZQYPGSUHSWQAG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |