C20H24FN3O4 — CID 18164688
N-[2-(4-ethoxyphenoxy)ethyl]-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide (PubChem CID 18164688) has the molecular formula C20H24FN3O4 and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenoxy)ethyl]-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide.
| Compound Name | N-[2-(4-ethoxyphenoxy)ethyl]-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide |
|---|---|
| PubChem CID | 18164688 |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[2-(4-ethoxyphenoxy)ethyl]-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide |
| SMILES | CCOc1ccc(OCCNC(=O)CNC(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H24FN3O4/c1-2-27-17-7-9-18(10-8-17)28-12-11-22-19(25)14-24-20(26)23-13-15-3-5-16(21)6-4-15/h3-10H,2,11-14H2,1H3,(H,22,25)(H2,23,24,26) |
| InChIKey | XNPYTARYFGAJBQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|