C10H12FN3OS — CID 8789219
1-[[2-(4-fluorophenyl)acetyl]amino]-3-methylthiourea (PubChem CID 8789219) has the molecular formula C10H12FN3OS and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-[[2-(4-fluorophenyl)acetyl]amino]-3-methylthiourea.
| Compound Name | 1-[[2-(4-fluorophenyl)acetyl]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 8789219 |
| Molecular Formula | C10H12FN3OS |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-[[2-(4-fluorophenyl)acetyl]amino]-3-methylthiourea |
| SMILES | CNC(=S)NNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C10H12FN3OS/c1-12-10(16)14-13-9(15)6-7-2-4-8(11)5-3-7/h2-5H,6H2,1H3,(H,13,15)(H2,12,14,16) |
| InChIKey | YSCOZQDDOYLAEB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|