C8H9FN2O2 — CID 61312351
methyl 2-[(5-fluoro-2-pyridinyl)amino]acetate (PubChem CID 61312351) has the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. Its IUPAC name is methyl 2-[(5-fluoro-2-pyridinyl)amino]acetate.
| Compound Name | methyl 2-[(5-fluoro-2-pyridinyl)amino]acetate |
|---|---|
| PubChem CID | 61312351 |
| Molecular Formula | C8H9FN2O2 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | methyl 2-[(5-fluoro-2-pyridinyl)amino]acetate |
| SMILES | COC(=O)CNc1ccc(F)cn1 |
| InChI | InChI=1S/C8H9FN2O2/c1-13-8(12)5-11-7-3-2-6(9)4-10-7/h2-4H,5H2,1H3,(H,10,11) |
| InChIKey | MYWJPZSFBQNZPW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |