C9H9F2NO2 — CID 28574625
methyl 2-(2,5-difluoroanilino)acetate (PubChem CID 28574625) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is methyl 2-(2,5-difluoroanilino)acetate.
| Compound Name | methyl 2-(2,5-difluoroanilino)acetate |
|---|---|
| PubChem CID | 28574625 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | methyl 2-(2,5-difluoroanilino)acetate |
| SMILES | COC(=O)CNc1cc(F)ccc1F |
| InChI | InChI=1S/C9H9F2NO2/c1-14-9(13)5-12-8-4-6(10)2-3-7(8)11/h2-4,12H,5H2,1H3 |
| InChIKey | ZFHYJVDSGCVKKM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |