methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate

C13H17F2NO2 — CID 115253297

IUPACmethyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate
SMILESCOC(=O)C(CNc1cc(F)ccc1F)C(C)C
InChIInChI=1S/C13H17F2NO2/c1-8(2)10(13(17)18-3)7-16-12-6-9(14)4-5-11(12)15/h4-6,8,10,16H,7H2,1-3H3
InChIKeyMTHZOZAEPIOBHF-UHFFFAOYSA-N
MW257.28 g/mol
LogP2.82
Rot. Bonds5

About methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate

methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate (PubChem CID 115253297) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate.

Molecular Properties

Compound Namemethyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate
PubChem CID115253297
Molecular FormulaC13H17F2NO2
Molecular Weight257.28 g/mol
Exact Mass257.12
IUPAC Namemethyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate
SMILESCOC(=O)C(CNc1cc(F)ccc1F)C(C)C
InChIInChI=1S/C13H17F2NO2/c1-8(2)10(13(17)18-3)7-16-12-6-9(14)4-5-11(12)15/h4-6,8,10,16H,7H2,1-3H3
InChIKeyMTHZOZAEPIOBHF-UHFFFAOYSA-N
XLogP2.82
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.28
LogP ≤ 52.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate?
The IUPAC name of methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate (CID 115253297) is methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate.
What is the SMILES notation for methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate?
The canonical SMILES for methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate is COC(=O)C(CNc1cc(F)ccc1F)C(C)C.
What is the InChIKey of methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate?
The InChIKey is MTHZOZAEPIOBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2NO2/c1-8(2)10(13(17)18-3)7-16-12-6-9(14)4-5-11(12)15/h4-6,8,10,16H,7H2,1-3H3.
What are the key properties of methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate?
methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate has a molecular weight of 257.28 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,5-difluoroanilino)methyl]-3-methylbutanoate is sourced from PubChem (CID 115253297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).