C12H13FN2S — CID 61474267
5-fluoro-N-(1-thiophen-3-ylpropan-2-yl)pyridin-2-amine (PubChem CID 61474267) has the molecular formula C12H13FN2S and a molecular weight of 236.32 g/mol. Its IUPAC name is 5-fluoro-N-(1-thiophen-3-ylpropan-2-yl)pyridin-2-amine.
| Compound Name | 5-fluoro-N-(1-thiophen-3-ylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 61474267 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 5-fluoro-N-(1-thiophen-3-ylpropan-2-yl)pyridin-2-amine |
| SMILES | CC(Cc1ccsc1)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C12H13FN2S/c1-9(6-10-4-5-16-8-10)15-12-3-2-11(13)7-14-12/h2-5,7-9H,6H2,1H3,(H,14,15) |
| InChIKey | DNYIYSUZXHHFSE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |