C14H17N3OS — CID 135109399
1-[4-methyl-2-(1-thiophen-3-ylpropan-2-ylamino)pyrimidin-5-yl]ethanone (PubChem CID 135109399) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 1-[4-methyl-2-(1-thiophen-3-ylpropan-2-ylamino)pyrimidin-5-yl]ethanone.
| Compound Name | 1-[4-methyl-2-(1-thiophen-3-ylpropan-2-ylamino)pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 135109399 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-[4-methyl-2-(1-thiophen-3-ylpropan-2-ylamino)pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(NC(C)Cc2ccsc2)nc1C |
| InChI | InChI=1S/C14H17N3OS/c1-9(6-12-4-5-19-8-12)16-14-15-7-13(11(3)18)10(2)17-14/h4-5,7-9H,6H2,1-3H3,(H,15,16,17) |
| InChIKey | GHTCZIGKINEQOG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |