C13H20N6OS — CID 80901076
4-hydrazinyl-6-propoxy-N-(1-thiophen-3-ylpropan-2-yl)-1,3,5-triazin-2-amine (PubChem CID 80901076) has the molecular formula C13H20N6OS and a molecular weight of 308.41 g/mol. Its IUPAC name is 4-hydrazinyl-6-propoxy-N-(1-thiophen-3-ylpropan-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-propoxy-N-(1-thiophen-3-ylpropan-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80901076 |
| Molecular Formula | C13H20N6OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-hydrazinyl-6-propoxy-N-(1-thiophen-3-ylpropan-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(NN)nc(NC(C)Cc2ccsc2)n1 |
| InChI | InChI=1S/C13H20N6OS/c1-3-5-20-13-17-11(16-12(18-13)19-14)15-9(2)7-10-4-6-21-8-10/h4,6,8-9H,3,5,7,14H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | PHEBWPRPMKJGEC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|