C11H21N5O2 — CID 80909820
[4-(3-methylbutoxy)-6-propoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80909820) has the molecular formula C11H21N5O2 and a molecular weight of 255.32 g/mol. Its IUPAC name is [4-(3-methylbutoxy)-6-propoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(3-methylbutoxy)-6-propoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80909820 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | [4-(3-methylbutoxy)-6-propoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCCOc1nc(NN)nc(OCCC(C)C)n1 |
| InChI | InChI=1S/C11H21N5O2/c1-4-6-17-10-13-9(16-12)14-11(15-10)18-7-5-8(2)3/h8H,4-7,12H2,1-3H3,(H,13,14,15,16) |
| InChIKey | VZCWJJLAMQCVIE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|