C9H14F3N5O2 — CID 82958871
[4-propoxy-6-(3,3,3-trifluoropropoxy)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 82958871) has the molecular formula C9H14F3N5O2 and a molecular weight of 281.24 g/mol. Its IUPAC name is [4-propoxy-6-(3,3,3-trifluoropropoxy)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-propoxy-6-(3,3,3-trifluoropropoxy)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 82958871 |
| Molecular Formula | C9H14F3N5O2 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | [4-propoxy-6-(3,3,3-trifluoropropoxy)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCCOc1nc(NN)nc(OCCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H14F3N5O2/c1-2-4-18-7-14-6(17-13)15-8(16-7)19-5-3-9(10,11)12/h2-5,13H2,1H3,(H,14,15,16,17) |
| InChIKey | RVCUGWGVIDZMEO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|