C8H12F3N5O2 — CID 82794676
[4-methoxy-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 82794676) has the molecular formula C8H12F3N5O2 and a molecular weight of 267.21 g/mol. Its IUPAC name is [4-methoxy-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-methoxy-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 82794676 |
| Molecular Formula | C8H12F3N5O2 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | [4-methoxy-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | COc1nc(NN)nc(OCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H12F3N5O2/c1-17-6-13-5(16-12)14-7(15-6)18-4-2-3-8(9,10)11/h2-4,12H2,1H3,(H,13,14,15,16) |
| InChIKey | ZDIOWRDLRNNLEJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|