C6H9F3N6O — CID 80943261
4-hydrazinyl-6-methoxy-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine (PubChem CID 80943261) has the molecular formula C6H9F3N6O and a molecular weight of 238.17 g/mol. Its IUPAC name is 4-hydrazinyl-6-methoxy-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-methoxy-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80943261 |
| Molecular Formula | C6H9F3N6O |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-hydrazinyl-6-methoxy-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NN)nc(NCC(F)(F)F)n1 |
| InChI | InChI=1S/C6H9F3N6O/c1-16-5-13-3(11-2-6(7,8)9)12-4(14-5)15-10/h2,10H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | CZROJVRKGBYINK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|