C9H18N6O — CID 80920216
4-hydrazinyl-6-methoxy-N-(2-methylbutan-2-yl)-1,3,5-triazin-2-amine (PubChem CID 80920216) has the molecular formula C9H18N6O and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-hydrazinyl-6-methoxy-N-(2-methylbutan-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-methoxy-N-(2-methylbutan-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80920216 |
| Molecular Formula | C9H18N6O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4-hydrazinyl-6-methoxy-N-(2-methylbutan-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CCC(C)(C)Nc1nc(NN)nc(OC)n1 |
| InChI | InChI=1S/C9H18N6O/c1-5-9(2,3)14-6-11-7(15-10)13-8(12-6)16-4/h5,10H2,1-4H3,(H2,11,12,13,14,15) |
| InChIKey | MGVORPVRUIRMBJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|