C8H16N6O3S — CID 80903842
4-hydrazinyl-6-methoxy-N-(3-methylsulfonylpropyl)-1,3,5-triazin-2-amine (PubChem CID 80903842) has the molecular formula C8H16N6O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 4-hydrazinyl-6-methoxy-N-(3-methylsulfonylpropyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-methoxy-N-(3-methylsulfonylpropyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80903842 |
| Molecular Formula | C8H16N6O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-hydrazinyl-6-methoxy-N-(3-methylsulfonylpropyl)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NN)nc(NCCCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C8H16N6O3S/c1-17-8-12-6(11-7(13-8)14-9)10-4-3-5-18(2,15)16/h3-5,9H2,1-2H3,(H2,10,11,12,13,14) |
| InChIKey | YCRWMLQXJQOZRX-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|