C9H17N5O3S — CID 80812342
6-ethoxy-2-N-(3-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80812342) has the molecular formula C9H17N5O3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 6-ethoxy-2-N-(3-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-2-N-(3-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80812342 |
| Molecular Formula | C9H17N5O3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 6-ethoxy-2-N-(3-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1nc(N)nc(NCCCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C9H17N5O3S/c1-3-17-9-13-7(10)12-8(14-9)11-5-4-6-18(2,15)16/h3-6H2,1-2H3,(H3,10,11,12,13,14) |
| InChIKey | GRWMPRWRTOZMNM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|