C7H14N6O3S — CID 80787981
N-[2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide (PubChem CID 80787981) has the molecular formula C7H14N6O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is N-[2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 80787981 |
| Molecular Formula | C7H14N6O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | N-[2-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)amino]ethyl]methanesulfonamide |
| SMILES | COc1nc(N)nc(NCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C7H14N6O3S/c1-16-7-12-5(8)11-6(13-7)9-3-4-10-17(2,14)15/h10H,3-4H2,1-2H3,(H3,8,9,11,12,13) |
| InChIKey | ZPAHPUFXSDQYQB-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|