C8H15N5OS — CID 80839887
6-methoxy-2-N-(3-methylsulfanylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80839887) has the molecular formula C8H15N5OS and a molecular weight of 229.31 g/mol. Its IUPAC name is 6-methoxy-2-N-(3-methylsulfanylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-methoxy-2-N-(3-methylsulfanylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80839887 |
| Molecular Formula | C8H15N5OS |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 6-methoxy-2-N-(3-methylsulfanylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1nc(N)nc(NCCCSC)n1 |
| InChI | InChI=1S/C8H15N5OS/c1-14-8-12-6(9)11-7(13-8)10-4-3-5-15-2/h3-5H2,1-2H3,(H3,9,10,11,12,13) |
| InChIKey | GFOOPWIWJSDLBJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|