C8H15N5O2 — CID 80772035
3-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]propan-1-ol (PubChem CID 80772035) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]propan-1-ol.
| Compound Name | 3-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 80772035 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-[(4-amino-6-ethoxy-1,3,5-triazin-2-yl)amino]propan-1-ol |
| SMILES | CCOc1nc(N)nc(NCCCO)n1 |
| InChI | InChI=1S/C8H15N5O2/c1-2-15-8-12-6(9)11-7(13-8)10-4-3-5-14/h14H,2-5H2,1H3,(H3,9,10,11,12,13) |
| InChIKey | ZCKDJMISXOEMFC-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|