C10H19N5O — CID 80832748
6-ethoxy-2-N-(2-methylbutyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80832748) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 6-ethoxy-2-N-(2-methylbutyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-2-N-(2-methylbutyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80832748 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 6-ethoxy-2-N-(2-methylbutyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1nc(N)nc(NCC(C)CC)n1 |
| InChI | InChI=1S/C10H19N5O/c1-4-7(3)6-12-9-13-8(11)14-10(15-9)16-5-2/h7H,4-6H2,1-3H3,(H3,11,12,13,14,15) |
| InChIKey | AOXNFMRQLBRUQG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |