C9H16N4OS — CID 80887131
4-butan-2-ylsulfanyl-6-ethoxy-1,3,5-triazin-2-amine (PubChem CID 80887131) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-butan-2-ylsulfanyl-6-ethoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-butan-2-ylsulfanyl-6-ethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80887131 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-butan-2-ylsulfanyl-6-ethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(N)nc(SC(C)CC)n1 |
| InChI | InChI=1S/C9H16N4OS/c1-4-6(3)15-9-12-7(10)11-8(13-9)14-5-2/h6H,4-5H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | IZTGBJNSWLHBAC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |