C10H14N6S — CID 80887918
4-butan-2-ylsulfanyl-6-imidazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80887918) has the molecular formula C10H14N6S and a molecular weight of 250.33 g/mol. Its IUPAC name is 4-butan-2-ylsulfanyl-6-imidazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-butan-2-ylsulfanyl-6-imidazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80887918 |
| Molecular Formula | C10H14N6S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-butan-2-ylsulfanyl-6-imidazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCC(C)Sc1nc(N)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C10H14N6S/c1-3-7(2)17-10-14-8(11)13-9(15-10)16-5-4-12-6-16/h4-7H,3H2,1-2H3,(H2,11,13,14,15) |
| InChIKey | NGZYYOTVPXBCHK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |