C12H19N7 — CID 80764046
6-imidazol-1-yl-4-N,4-N-dipropyl-1,3,5-triazine-2,4-diamine (PubChem CID 80764046) has the molecular formula C12H19N7 and a molecular weight of 261.33 g/mol. Its IUPAC name is 6-imidazol-1-yl-4-N,4-N-dipropyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-imidazol-1-yl-4-N,4-N-dipropyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80764046 |
| Molecular Formula | C12H19N7 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 6-imidazol-1-yl-4-N,4-N-dipropyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCN(CCC)c1nc(N)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C12H19N7/c1-3-6-18(7-4-2)11-15-10(13)16-12(17-11)19-8-5-14-9-19/h5,8-9H,3-4,6-7H2,1-2H3,(H2,13,15,16,17) |
| InChIKey | ZFOHHLLWEDJONU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |