C13H20N8 — CID 80900414
N-(cyclopropylmethyl)-4-hydrazinyl-6-imidazol-1-yl-N-propyl-1,3,5-triazin-2-amine (PubChem CID 80900414) has the molecular formula C13H20N8 and a molecular weight of 288.36 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-hydrazinyl-6-imidazol-1-yl-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | N-(cyclopropylmethyl)-4-hydrazinyl-6-imidazol-1-yl-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80900414 |
| Molecular Formula | C13H20N8 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-(cyclopropylmethyl)-4-hydrazinyl-6-imidazol-1-yl-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCN(CC1CC1)c1nc(NN)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C13H20N8/c1-2-6-20(8-10-3-4-10)12-16-11(19-14)17-13(18-12)21-7-5-15-9-21/h5,7,9-10H,2-4,6,8,14H2,1H3,(H,16,17,18,19) |
| InChIKey | GGLHXTRRGJZMAK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|