C12H20N8 — CID 80931860
4-hydrazinyl-6-imidazol-1-yl-N,N-dipropyl-1,3,5-triazin-2-amine (PubChem CID 80931860) has the molecular formula C12H20N8 and a molecular weight of 276.35 g/mol. Its IUPAC name is 4-hydrazinyl-6-imidazol-1-yl-N,N-dipropyl-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-imidazol-1-yl-N,N-dipropyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80931860 |
| Molecular Formula | C12H20N8 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-hydrazinyl-6-imidazol-1-yl-N,N-dipropyl-1,3,5-triazin-2-amine |
| SMILES | CCCN(CCC)c1nc(NN)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C12H20N8/c1-3-6-19(7-4-2)11-15-10(18-13)16-12(17-11)20-8-5-14-9-20/h5,8-9H,3-4,6-7,13H2,1-2H3,(H,15,16,17,18) |
| InChIKey | CBXWJJRETDHFHQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|