C11H19N9 — CID 80919698
N'-ethyl-N-(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)-N'-methylethane-1,2-diamine (PubChem CID 80919698) has the molecular formula C11H19N9 and a molecular weight of 277.34 g/mol. Its IUPAC name is N'-ethyl-N-(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N-(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 80919698 |
| Molecular Formula | C11H19N9 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N'-ethyl-N-(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNc1nc(NN)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C11H19N9/c1-3-19(2)6-5-14-9-15-10(18-12)17-11(16-9)20-7-4-13-8-20/h4,7-8H,3,5-6,12H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | HMKMSSTYRMSLBT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|