C11H18N8O — CID 80914978
1-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-2-methylbutan-2-ol (PubChem CID 80914978) has the molecular formula C11H18N8O and a molecular weight of 278.32 g/mol. Its IUPAC name is 1-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-2-methylbutan-2-ol.
| Compound Name | 1-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 80914978 |
| Molecular Formula | C11H18N8O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-2-methylbutan-2-ol |
| SMILES | CCC(C)(O)CNc1nc(NN)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C11H18N8O/c1-3-11(2,20)6-14-8-15-9(18-12)17-10(16-8)19-5-4-13-7-19/h4-5,7,20H,3,6,12H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | GKGFGUJVUYKXEV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|