C11H12N8S — CID 80914496
4-hydrazinyl-6-imidazol-1-yl-N-(thiophen-3-ylmethyl)-1,3,5-triazin-2-amine (PubChem CID 80914496) has the molecular formula C11H12N8S and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-hydrazinyl-6-imidazol-1-yl-N-(thiophen-3-ylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-imidazol-1-yl-N-(thiophen-3-ylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80914496 |
| Molecular Formula | C11H12N8S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-hydrazinyl-6-imidazol-1-yl-N-(thiophen-3-ylmethyl)-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NCc2ccsc2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C11H12N8S/c12-18-10-15-9(14-5-8-1-4-20-6-8)16-11(17-10)19-3-2-13-7-19/h1-4,6-7H,5,12H2,(H2,14,15,16,17,18) |
| InChIKey | WFXKVAJVCMFWAI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|