C8H9F3N8 — CID 80943000
4-hydrazinyl-6-imidazol-1-yl-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine (PubChem CID 80943000) has the molecular formula C8H9F3N8 and a molecular weight of 274.21 g/mol. Its IUPAC name is 4-hydrazinyl-6-imidazol-1-yl-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-imidazol-1-yl-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80943000 |
| Molecular Formula | C8H9F3N8 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-hydrazinyl-6-imidazol-1-yl-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NCC(F)(F)F)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C8H9F3N8/c9-8(10,11)3-14-5-15-6(18-12)17-7(16-5)19-2-1-13-4-19/h1-2,4H,3,12H2,(H2,14,15,16,17,18) |
| InChIKey | ARTMHTOOYBSVAZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|