C9H14N8O — CID 80944977
3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol (PubChem CID 80944977) has the molecular formula C9H14N8O and a molecular weight of 250.27 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol.
| Compound Name | 3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 80944977 |
| Molecular Formula | C9H14N8O |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]propan-1-ol |
| SMILES | NNc1nc(NCCCO)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C9H14N8O/c10-16-8-13-7(12-2-1-5-18)14-9(15-8)17-4-3-11-6-17/h3-4,6,18H,1-2,5,10H2,(H2,12,13,14,15,16) |
| InChIKey | APXDMOXMHHVJPD-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|