C13H21N7O — CID 107324013
5-[[4-(ethylamino)-6-imidazol-1-yl-1,3,5-triazin-2-yl]amino]pentan-1-ol (PubChem CID 107324013) has the molecular formula C13H21N7O and a molecular weight of 291.36 g/mol. Its IUPAC name is 5-[[4-(ethylamino)-6-imidazol-1-yl-1,3,5-triazin-2-yl]amino]pentan-1-ol.
| Compound Name | 5-[[4-(ethylamino)-6-imidazol-1-yl-1,3,5-triazin-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 107324013 |
| Molecular Formula | C13H21N7O |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 5-[[4-(ethylamino)-6-imidazol-1-yl-1,3,5-triazin-2-yl]amino]pentan-1-ol |
| SMILES | CCNc1nc(NCCCCCO)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C13H21N7O/c1-2-15-11-17-12(16-6-4-3-5-9-21)19-13(18-11)20-8-7-14-10-20/h7-8,10,21H,2-6,9H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | BREZUFPZNHBUDZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|