C8H11N7OS — CID 80921833
2-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)sulfanyl]ethanol (PubChem CID 80921833) has the molecular formula C8H11N7OS and a molecular weight of 253.29 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)sulfanyl]ethanol.
| Compound Name | 2-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)sulfanyl]ethanol |
|---|---|
| PubChem CID | 80921833 |
| Molecular Formula | C8H11N7OS |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)sulfanyl]ethanol |
| SMILES | NNc1nc(SCCO)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C8H11N7OS/c9-14-6-11-7(15-2-1-10-5-15)13-8(12-6)17-4-3-16/h1-2,5,16H,3-4,9H2,(H,11,12,13,14) |
| InChIKey | YGUKFACRFYYEKH-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|