C11H18N8O2 — CID 106163591
3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-4-methoxybutan-1-ol (PubChem CID 106163591) has the molecular formula C11H18N8O2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-4-methoxybutan-1-ol.
| Compound Name | 3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 106163591 |
| Molecular Formula | C11H18N8O2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)Nc1nc(NN)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C11H18N8O2/c1-21-6-8(2-5-20)14-9-15-10(18-12)17-11(16-9)19-4-3-13-7-19/h3-4,7-8,20H,2,5-6,12H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | NCWHKGJGYQCVBH-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|