C11H17N9O — CID 106347620
2-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-3-methylbutanamide (PubChem CID 106347620) has the molecular formula C11H17N9O and a molecular weight of 291.32 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-3-methylbutanamide.
| Compound Name | 2-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106347620 |
| Molecular Formula | C11H17N9O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-3-methylbutanamide |
| SMILES | CC(C)C(Nc1nc(NN)nc(-n2ccnc2)n1)C(N)=O |
| InChI | InChI=1S/C11H17N9O/c1-6(2)7(8(12)21)15-9-16-10(19-13)18-11(17-9)20-4-3-14-5-20/h3-7H,13H2,1-2H3,(H2,12,21)(H2,15,16,17,18,19) |
| InChIKey | ZGMOOKVITXHORH-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 149.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|