C8H13N9 — CID 83027475
2-(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine (PubChem CID 83027475) has the molecular formula C8H13N9 and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83027475 |
| Molecular Formula | C8H13N9 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1nc(NN)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C8H13N9/c1-16(2)15-7-11-6(14-9)12-8(13-7)17-4-3-10-5-17/h3-5H,9H2,1-2H3,(H2,11,12,13,14,15) |
| InChIKey | WFOUSCALAVHFCD-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|