C10H14N8 — CID 80918567
N-cyclobutyl-4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80918567) has the molecular formula C10H14N8 and a molecular weight of 246.28 g/mol. Its IUPAC name is N-cyclobutyl-4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-cyclobutyl-4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80918567 |
| Molecular Formula | C10H14N8 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | N-cyclobutyl-4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NC2CCC2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C10H14N8/c11-17-9-14-8(13-7-2-1-3-7)15-10(16-9)18-5-4-12-6-18/h4-7H,1-3,11H2,(H2,13,14,15,16,17) |
| InChIKey | SVAJJCKLAWJFEG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|