C9H13N9 — CID 80918885
N-cyclobutyl-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80918885) has the molecular formula C9H13N9 and a molecular weight of 247.27 g/mol. Its IUPAC name is N-cyclobutyl-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-cyclobutyl-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80918885 |
| Molecular Formula | C9H13N9 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-cyclobutyl-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NC2CCC2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H13N9/c10-17-8-14-7(13-6-2-1-3-6)15-9(16-8)18-5-11-4-12-18/h4-6H,1-3,10H2,(H2,13,14,15,16,17) |
| InChIKey | VEJYPLYPLRMZII-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|