C13H19N7O — CID 80907359
[4-imidazol-1-yl-6-(2-methylcyclohexyl)oxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80907359) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is [4-imidazol-1-yl-6-(2-methylcyclohexyl)oxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-imidazol-1-yl-6-(2-methylcyclohexyl)oxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80907359 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [4-imidazol-1-yl-6-(2-methylcyclohexyl)oxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CC1CCCCC1Oc1nc(NN)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C13H19N7O/c1-9-4-2-3-5-10(9)21-13-17-11(19-14)16-12(18-13)20-7-6-15-8-20/h6-10H,2-5,14H2,1H3,(H,16,17,18,19) |
| InChIKey | QPSRDYZYLIYANP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|