C13H13N7O — CID 80906719
(4-imidazol-1-yl-6-phenylmethoxy-1,3,5-triazin-2-yl)hydrazine (PubChem CID 80906719) has the molecular formula C13H13N7O and a molecular weight of 283.30 g/mol. Its IUPAC name is (4-imidazol-1-yl-6-phenylmethoxy-1,3,5-triazin-2-yl)hydrazine.
| Compound Name | (4-imidazol-1-yl-6-phenylmethoxy-1,3,5-triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80906719 |
| Molecular Formula | C13H13N7O |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (4-imidazol-1-yl-6-phenylmethoxy-1,3,5-triazin-2-yl)hydrazine |
| SMILES | NNc1nc(OCc2ccccc2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C13H13N7O/c14-19-11-16-12(20-7-6-15-9-20)18-13(17-11)21-8-10-4-2-1-3-5-10/h1-7,9H,8,14H2,(H,16,17,18,19) |
| InChIKey | LNMYXYVPISRHFE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|