C13H14N8 — CID 80911395
N-benzyl-4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80911395) has the molecular formula C13H14N8 and a molecular weight of 282.31 g/mol. Its IUPAC name is N-benzyl-4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-benzyl-4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80911395 |
| Molecular Formula | C13H14N8 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | N-benzyl-4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NCc2ccccc2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C13H14N8/c14-20-12-17-11(16-8-10-4-2-1-3-5-10)18-13(19-12)21-7-6-15-9-21/h1-7,9H,8,14H2,(H2,16,17,18,19,20) |
| InChIKey | UQRGAIFLXWEDQA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|