C12H20N8O — CID 106294518
1-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-2-methylpentan-2-ol (PubChem CID 106294518) has the molecular formula C12H20N8O and a molecular weight of 292.35 g/mol. Its IUPAC name is 1-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-2-methylpentan-2-ol.
| Compound Name | 1-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 106294518 |
| Molecular Formula | C12H20N8O |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]-2-methylpentan-2-ol |
| SMILES | CCCC(C)(O)CNc1nc(NN)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C12H20N8O/c1-3-4-12(2,21)7-15-9-16-10(19-13)18-11(17-9)20-6-5-14-8-20/h5-6,8,21H,3-4,7,13H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | AOYCADLNXSVMJM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|