C8H7N9S2 — CID 80930718
[4-imidazol-1-yl-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80930718) has the molecular formula C8H7N9S2 and a molecular weight of 293.34 g/mol. Its IUPAC name is [4-imidazol-1-yl-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-imidazol-1-yl-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80930718 |
| Molecular Formula | C8H7N9S2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | [4-imidazol-1-yl-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | NNc1nc(Sc2nncs2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C8H7N9S2/c9-15-5-12-6(17-2-1-10-3-17)14-7(13-5)19-8-16-11-4-18-8/h1-4H,9H2,(H,12,13,14,15) |
| InChIKey | QPUWHSGITZZBKM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|